Identification |
Name: | o-Toluoyl chloride |
Synonyms: | 2-Methylbenzoyl chloride;Toluoylchloride;ortho-toluoyl chloride;O-METHYL-BENZOYL-CHLORIDE;O-METHYL BENZOYL CHLORIDE;methylbenzoyl chloride |
CAS: | 933-88-0;37808-28-9 |
EINECS: | 213-273-8; |
Molecular Formula: | C8H7ClO |
Molecular Weight: | 154.6 |
InChI: | InChI=1/C8H7ClO/c1-6-4-2-3-5-7(6)8(9)10/h2-5H,1H3 |
Molecular Structure: |
 |
Properties |
Transport: | UN 3265 8/PG 2 |
Density: | 1.185 |
Refractive index: | 1.554-1.556 |
Solubility: | Decomposes in water |
Appearance: | clear pale yellow to yellow to faintly pink liquid |
Safety Data |
|
 |