| Identification |
| Name: | o-Toluoyl chloride |
| Synonyms: | 2-Methylbenzoyl chloride;Toluoylchloride;ortho-toluoyl chloride;O-METHYL-BENZOYL-CHLORIDE;O-METHYL BENZOYL CHLORIDE;methylbenzoyl chloride |
| CAS: | 933-88-0;37808-28-9 |
| EINECS: | 213-273-8; |
| Molecular Formula: | C8H7ClO |
| Molecular Weight: | 154.6 |
| InChI: | InChI=1/C8H7ClO/c1-6-4-2-3-5-7(6)8(9)10/h2-5H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3265 8/PG 2 |
| Density: | 1.185 |
| Refractive index: | 1.554-1.556 |
| Solubility: | Decomposes in water |
| Appearance: | clear pale yellow to yellow to faintly pink liquid |
| Safety Data |
| |
 |
