| Identification | |
| Name: | benzyloxymethylbenzene; 2-methyloxirane; oxirane |
| Synonyms: | 68511-22-8;AC1L58QU;Polyoxyethylene-polyoxypropylene alpha,omega-dibenzylether;benzyloxymethylbenzene; 2-methyloxirane; oxirane;2-methyloxirane; oxirane; phenylmethoxymethylbenzene;Oxirane, methyl-, polymer with oxirane, bis(phenylmethyl) ether;Oxirane, 2-methyl-, polymer with oxirane, bis(phenylmethyl) ether;86675-70-9 |
| CAS: | 68511-22-8;86675-70-9 |
| Molecular Formula: | C19H24O3 |
| Molecular Weight: | 300.3921 |
| InChI: | InChI=1/C14H14O.C3H6O.C2H4O/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;1-3-2-4-3;1-2-3-1/h1-10H,11-12H2;3H,2H2,1H3;1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 135°C |
| Boiling Point: | 286.9°C at 760 mmHg |
| Flash Point: | 135°C |
| Safety Data | |
 |
|
