| Identification | |
| Name: | ethyl prop-2-enoate - prop-2-enenitrile (1:1) |
| Synonyms: | ethyl prop-2-enoate- prop-2-enenitrile(1:1);2-Propenoic acid, ethyl ester, polymer with 2-propenenitrile;100359-70-4;25053-12-7;AC1L51HX;Acrylic acid ethyl ester, polymer with acrylonitrile;AC1Q4Q69;AR-1J0010;Ethyl acrylate, acrylonitrile polymer;ethyl prop-2-enoate; prop-2-enenitrile;Ethyl 2-propenoate, 2-propenenitrile polymer;ethyl prop-2-enoate - prop-2-enenitrile (1:1) |
| CAS: | 100359-70-4;25053-12-7 |
| Molecular Formula: | C8H11NO2 |
| Molecular Weight: | 153.1784 |
| InChI: | InChI=1/C5H8O2.C3H3N/c1-3-5(6)7-4-2;1-2-3-4/h3H,1,4H2,2H3;2H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 15.6°C |
| Boiling Point: | 99.5°C at 760 mmHg |
| Flash Point: | 15.6°C |
| Safety Data | |
 |
|
