| Identification | |
| Name: | 2,2',2''-nitrilotriethanol - chloromethane (1:1) |
| Synonyms: | 68609-18-7;AC1L58VM;Poly(triethanolamine)ether, methyl chloride quaternized;2-[bis(2-hydroxyethyl)amino]ethanol; chloromethane;2,2',2''-nitrilotriethanol - chloromethane (1:1);Triethanolamine condensate polymer, methyl chloride alkylate;Ethanol, 2,2',2''-nitrilotris-, homopolymer, compd. with chloromethane;Ethanol, 2,2',2''-nitrilotris-, homopolymer, reaction products with chloromethane;68609-19-8;68938-70-5 |
| CAS: | 68609-18-7;68609-19-8;68938-70-5 |
| Molecular Formula: | C7H18ClNO3 |
| Molecular Weight: | 199.6757 |
| InChI: | InChI=1/C6H15NO3.CH3Cl/c8-4-1-7(2-5-9)3-6-10;1-2/h8-10H,1-6H2;1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 185°C |
| Boiling Point: | 335.4°C at 760 mmHg |
| Flash Point: | 185°C |
| Safety Data | |
 |
|
