Identification |
Name: | 2-methyloxirane; (E)-octadec-9-enoic acid; oxirane |
Synonyms: | Oxirane, methyl-, polymer with oxirane, mono-9-octadecenoate, (Z)-;9009-39-6;2-methyloxirane; (E)-octadec-9-enoic acid; oxirane;AC1O5V2N;Oxirane, methyl-, polymer with oxirane, mono-(9Z)-9-octadecenoate;Oxirane, 2-methyl-, polymer with oxirane, mono-(9Z)-9-octadecenoate;37251-68-6;63310-17-8 |
CAS: | 37251-68-6;63310-17-8;9009-39-6 |
Molecular Formula: | C23H44O4 |
Molecular Weight: | 384.5931 |
InChI: | InChI=1/C18H34O2.C3H6O.C2H4O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-2-4-3;1-2-3-1/h9-10H,2-8,11-17H2,1H3,(H,19,20);3H,2H2,1H3;1-2H2/b10-9+;; |
Molecular Structure: |
|
Properties |
Flash Point: | 270.1°C |
Boiling Point: | 360°C at 760 mmHg |
Flash Point: | 270.1°C |
Safety Data |
|
|