| Identification | |
| Name: | dimethylcarbamic acid |
| Synonyms: | Dimethylammonium dimethylcarbamate;Dimcarb;dimethylcarbamic acid- n-methylmethanamine(1:1);Dimethylamine carbon dioxide complex;AC1Q5WVU;AC1L4W8L;408395_ALDRICH;Dimethylcarbamic acid compd. with dimethylamine (1:1);39425_FLUKA;AR-1I5832;dimethylcarbamic acid; N-methylmethanamine;I04-10036;Carbamic acid, dimethyl-, compd. with dimethylamine (1:1);Carbamic acid, dimethyl-, compd. with N-methylmethanamine (1:1) |
| CAS: | 4137-10-4;7260-94-8 |
| Molecular Formula: | C3H7NO2 |
| Molecular Weight: | 89.0932 |
| InChI: | InChI=1/C3H7NO2/c1-4(2)3(5)6/h1-2H3,(H,5,6) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2733 |
| Melting Point: | °C |
| Flash Point: | 41.3°C |
| Boiling Point: | 144.7°C at 760 mmHg |
| Density: | 1.114g/cm3 |
| Refractive index: | 1.444 |
| Appearance: | clear colorless to light yellow liquid |
| Flash Point: | 41.3°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
