| Identification | |
| Name: | 4-Nitrophenol |
| Synonyms: | P-Nitro phenol; P-Nitrophenol; |
| CAS: | 100-02-7 |
| EINECS: | 202-811-7 |
| Molecular Formula: | C6H5NO3 |
| Molecular Weight: | 139.11 |
| InChI: | InChI=1/C6H5NO3/c8-6-3-1-5(2-4-6)7(9)10/h1-4,8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1663 6.1/PG 3 |
| Density: | 1.481 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases, organics, combustible material, reducing agents. Combustible. |
| Solubility: | Slightly soluble (1.6 g/100ml) |
| Appearance: | yellow to brown crystals |
| Specification: |
4-Nitrophenol (CAS NO.100-02-7), its Synonyms are p-Nitrophenol ; 4-Hydroxynitrobenzene ; Paranitrofenol ; Phenol, 4-nitro- ; Phenol, p-nitro- ; p-Hydroxynitrobenzene ; Paranitrophenol . It is white to light yellow crystalline solid. |
| Report: |
EPA Genetic Toxicology Program. Community Right-To-Know List. Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29089000 |
| Storage Temperature: | Store in dark! |
| Sensitive: | Light Sensitive |
| Color: | Colorless to slightly yellow crystals YELLOW TO BROWN SOLID |
| Usage: | As indicator in 0.1% Alcohol soln, ph range: 5.6 Colorless, 7.6 Yellow. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
