| Identification | |
| Name: | Ethanol, 1,2-dichloro-,1-acetate |
| Synonyms: | Ethanol,1,2-dichloro-, acetate (6CI,7CI,8CI,9CI); 1,2-Dichloroethanol acetate;1,2-Dichloroethyl acetate |
| CAS: | 10140-87-1 |
| EINECS: | 233-398-1 |
| Molecular Formula: | C4H6 Cl2 O2 |
| Molecular Weight: | 157.00 |
| InChI: | InChI=1/C4H6Cl2O2/c1-3(7)8-4(6)2-5/h4H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | Freezing point: less than -32 deg C |
| Density: | 1.295 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.4446 (20 C) |
| Solubility: | PARTIALLY SOLUBLE |
| Appearance: | VISCOUS CLEAR LIQUID. |
| Report: |
EPA Extremely Hazardous Substances List. |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | Water-white liquid |
| Usage: | Organic synthesis. |
| Safety Data | |
 |
|
