| Identification | ||
| Name: | 4-Chlorotoluene | |
| Synonyms: | 1-chloro-4-methylbenzene; 4-Chloro-1-methyl-benzene; p-tolyl chloride; PCT; 4-chloro toluene; ; p-Chlorotoluene; 4-Chloro-1-methyl-benzene; 1-Chloro-4-methylbenzene | |
| CAS: | 106-43-4 | |
| EINECS: | 203-397-0 | |
| Molecular Formula: | C7H7Cl | |
| Molecular Weight: | 126.58 | |
| InChI: | InChI=1/C7H7Cl/c1-6-2-4-7(8)5-3-6/h2-5H,1H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 2238 | |
| Density: | 1.07 | |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. | |
| Refractive index: | 1.519-1.521 | |
| Water Solubility: | <0.1 g/100 mL at 20 ºC | |
| Appearance: | clear liquid | |
| Specification: |
?4-chlorotoluene , its CAS NO. is 106-43-4, the synonyms are Synonyms? 1-Chloro-4-methylbenzene ; 1-Methyl-4-chlorobenzene ; 4-Chloro-1-methylbenzene ; 4-Chlorotoluene ; Benzene, 1-chloro-4-methyl- ; Toluene, p-chloro- ; p-Chlorotoluene ; p-Tolyl chloride . | |
| Packinggroup: | III | |
| HS Code: | 29036990 | |
| Color: | Colorless liquid | |
| Usage: | Solvent & intermediate for organic chemicals & dyes. | |
| Safety Data | ||
| Hazard Symbols |
Xn:Harmful
|
|
 |
||
