| Identification | |
| Name: | 2-Chlorotoluene |
| Synonyms: | 1-Chloro-2-Methylbenzene; 1-Methyl-2-chlorobenzene; 2-Chloro-1-Methylbenzene; o-Chlorotoluene; 2-Methylchlorobenzene; o-tolyl chloride; OCT; 2-chloro toluene; |
| CAS: | 95-49-8 |
| EINECS: | 202-424-3 |
| Molecular Formula: | C7H7Cl |
| Molecular Weight: | 126.58 |
| InChI: | InChI=1/C7H7Cl/c1-6-4-2-3-5-7(6)8/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2238 |
| Density: | 1.082 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.524-1.526 |
| Water Solubility: | slightly soluble |
| Solubility: | Slightly soluble SOLVENT Soluble in alcohol, chloroform, benzene, and ether |
| Appearance: | clear liquid |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Color: | Colorless liquid. |
| Usage: | Solvent, dyestuff intermediate, in organic syntheses. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
