| Identification | |
| Name: | 3-Chlorotoluene |
| Synonyms: | 1-chloro-3-methylbenzene; m-tolyl chloride |
| CAS: | 108-41-8 |
| EINECS: | 203-580-5 |
| Molecular Formula: | C7H7Cl |
| Molecular Weight: | 126.58 |
| InChI: | InChI=1/C7H7Cl/c1-6-3-2-4-7(8)5-6/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2238 |
| Density: | 1.072 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.521-1.523 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble in Water |
| Appearance: | colorless transparent liquid |
| Specification: | colourless liquid Safety Statements:24/25-61 24/25:Avoid contact with skin and eyes 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Packinggroup: | III |
| Storage Temperature: | 0-6°C |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
N:Dangerousfortheenvironment
|
 |
|
