| Identification | |
| Name: | P-Chlorophenol |
| Synonyms: | 4-Chlorophenol solution; Parachlorophenol; Para chlorophenol; 4-chloro phenol; 4-chloro-1-hydroxybenzene; 4-chloro-pheno; 4-Chlorophenol(form2); 4-chloro-phenole; Applied 3-78; applied3-78; chlorophenols,solid; p-Chlorfenol; P-CHLORO PHENOL; 4-Hydroxychlorobenzene |
| CAS: | 106-48-9 |
| EINECS: | 203-402-6 |
| Molecular Formula: | C6H5ClO |
| Molecular Weight: | 128.56 |
| InChI: | InChI=1/C6H5ClO/c7-5-1-3-6(8)4-2-5/h1-4,8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2904/2905/2020 |
| Density: | 1.306 |
| Stability: | Stable. Incompatible with acid chlorides, acid anhydrides, oxidizing agents, iron. |
| Refractive index: | 1.5579 |
| Solubility: | Soluble |
| Appearance: | off-white to light tan crystals or powder |
| Specification: |
? 4-Chlorophenol (CAS NO.106-48-9), its Synonyms are Parachlorophenol ; Phenol, 4-chloro- ; p-Chlorophenol ; 4-Chloro-1-hydroxybenzene ; 4-Hydroxychlorobenzene ; 4-Monochlorophenol ; Phenol, p-chloro- ; p-Chlorophenic acid . It is off-white to light tan crystals or powder. |
| Report: |
Reported in EPA TSCA Inventory. Chlorophenol compounds are on the Community Right-To-Know List. |
| Packinggroup: | III |
| HS Code: | 29081000 |
| Sensitive: | Air Sensitive |
| Color: | Needle like, white to straw-colored crystals White crystals (yellow or pink when impure) Yellow solid |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
