| Identification | |
| Name: | 3-Chlorophenol |
| Synonyms: | m-Chlorophenol; 3-Chloro-1-hydroxybenzene |
| CAS: | 108-43-0 |
| EINECS: | 203-582-6 |
| Molecular Formula: | C6H5ClO |
| Molecular Weight: | 128.56 |
| InChI: | InChI=1/C6H5ClO/c7-5-2-1-3-6(8)4-5/h1-4,8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2020 |
| Density: | 1.218 |
| Stability: | Stable. Combustible. Incompatible with acid chlorides, oxidizing agents, acid anhydrides. Discolours in air. |
| Refractive index: | 1.565-1.567 |
| Solubility: | 27.7 g/L (20 oC) |
| Appearance: | white crystalline solid with an unpleasant smell |
| Specification: | White to light yellow crystal. Safety Statements:28-61-28A 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Packinggroup: | III |
| HS Code: | 29081000 |
| Color: | Needles White crystals |
| Usage: | Intermediate in organic synthesis. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
