| Identification | |
| Name: | Boron,(N,N-dimethyl-1-octadecanamine)trihydro-, (T-4)- |
| Synonyms: | Octadecylamine,N,N-dimethyl-, compd. with BH3 (6CI,7CI); Octadecylamine, N,N-dimethyl-, compd.with borane (1:1) (8CI); 1-Octadecanamine, N,N-dimethyl-, boron complex;Borane, compd. with N,N-dimethyloctadecylamine (1:1) (8CI); 1-Octadecanamine,N,N-dimethyl-, compd. with borane (1:1); Borane, compd. withN,N-dimethyl-1-octadecanamine (1:1); Octadecylamine, N,N-dimethyl-, compd. withBH3 (1:1) |
| CAS: | 106555-98-0 |
| Molecular Formula: | C20H46 B N |
| Molecular Weight: | 311.3969 |
| InChI: | InChI=1S/C20H43N.B.3H/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)3;;;;/h4-20H2,1-3H3;;;;/q;+3;3*-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 153.8°C |
| Boiling Point: | 348.5°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 153.8°C |
| Safety Data | |
 |
|
