| Identification | |
| Name: | Butanoic acid,3-methyl-, butyl ester |
| Synonyms: | Isovalericacid, butyl ester (6CI,7CI,8CI);3-Methylbutyric acid butyl ester;Butyl3-methylbutanoate;Butyl 3-methylbutyrate;NSC 6187;n-Butyl3-methylbutyrate;n-Butyl isovalerate; |
| CAS: | 109-19-3 |
| EINECS: | 203-654-7 |
| Molecular Formula: | C9H18O2 |
| Molecular Weight: | 158.24 |
| InChI: | InChI=1/C9H18O2/c1-4-5-6-11-9(10)7-8(2)3/h8H,4-7H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1993 |
| Flash Point: | 145? |
| Density: | 0.858 |
| Refractive index: | 1.409 |
| Solubility: | Insol in water; sol in most organic solvents |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Packinggroup: | III |
| Flash Point: | 145? |
| Color: | Liquid |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
