| Identification | |
| Name: | Butanoic acid, 3-oxo-,butyl ester |
| Synonyms: | Acetoaceticacid, butyl ester (6CI,7CI,8CI); 3-Oxobutanoic acid butyl ester; Butyl3-oxobutanoate; Butyl 3-oxobutyrate; Butyl acetoacetate; NSC 97211; n-Butylacetoacetate |
| CAS: | 591-60-6 |
| EINECS: | 209-722-2 |
| Molecular Formula: | C8H14 O3 |
| Molecular Weight: | 158.22 |
| InChI: | InChI=1/C8H14O3/c1-3-4-5-11-8(10)6-7(2)9/h3-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.981g/cm3 |
| Refractive index: | 1.421 |
| Specification: |
Removal in wastewater treatment of Butyl acetoacetate (CAS No.591-60-6) can be stated as follows: |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | Z01 |
| Safety Data | |
 |
|
