| Identification | |
| Name: | Isoamyl formate |
| Synonyms: | 1-Butanol, 3-methyl-, formate; isopentyl formate; Natural Isoamyl Formate |
| CAS: | 110-45-2 |
| EINECS: | 203-769-2 |
| Molecular Formula: | C6H12O2 |
| Molecular Weight: | 116.16 |
| InChI: | InChI=1/C6H12O2/c1-6(2)3-4-8-5-7/h5-6H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1109 3 |
| Density: | 0.885 |
| Stability: | No data. |
| Refractive index: | 1.3976 |
| Solubility: | Insoluble |
| Specification: | Safety Statements:24-2 24:Avoid contact with skin 2:Keep out of the reach of children |
| Packinggroup: | III |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Usage: | Artificial fruit syrups. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
