| Identification | |
| Name: | Isoamyl acetate |
| Synonyms: | Isoamylacetatemixtureofisomers; Isopentyl acetate; Acetic Acid Isoamyl Ester |
| CAS: | 123-92-2 |
| EINECS: | 204-662-3 |
| Molecular Formula: | C7H14O2 |
| Molecular Weight: | 130.18 |
| InChI: | InChI=1/C7H14O2/c1-6(2)4-5-9-7(3)8/h6H,4-5H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1104 |
| Density: | 0.876 |
| Refractive index: | 1.399-1.401 |
| Water Solubility: | 0.20 g/100 mL. Slightly soluble |
| Solubility: | 0.20 g/100 mL. Slightly soluble in water |
| Appearance: | colourless liquid with a smell of bananas |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Color: | COLORLESS LIQUID |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
