| Identification | |
| Name: | Isoamyl geranate |
| Synonyms: | (e)-3,7-dimethyl-2,6-octadienoicacidisopentylester;3,7-dimethyl-,3-methylbutylester,(e)-6-octadienoicacid;3,7-dimethyl-,isopentylester,(e)-6-octadienoicacid;ISOAMYL GERANATE;3-methylbutyl (E)-3,7-dimethylocta-2,6-dienoate;2,6-Octadienoic acid, 3,7-dimethyl-, 3-methylbutyl ester, (2E)-;ISOAMYLGENERATE;3-Methylbutyl-(E)-3,7-dimethylocta-2,6-dienoat |
| CAS: | 68133-73-3 |
| EINECS: | 268-700-0 |
| Molecular Formula: | C15H26O2 |
| Molecular Weight: | 238.37 |
| InChI: | InChI=1/C15H26O2/c1-12(2)7-6-8-14(5)11-15(16)17-10-9-13(3)4/h7,11,13H,6,8-10H2,1-5H3/b14-11+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 143.4°C |
| Boiling Point: | 313.7°C at 760 mmHg |
| Density: | 0.893g/cm3 |
| Refractive index: | 1.459 |
| Specification: |
Isoamyl geranate with cas registry number of 68133-73-3 is also known as (E)-3,7-Dimethyl-2,6-octadienoic acid isopentyl ester ; 2,6-Octadienoic acid, 3,7-dimethyl-, 3-methylbutyl ester, (2E)- ; 2,6-Octadienoic acid, 3,7-dimethyl-, 3-methylbutyl ester, (E)- ; 2,6-Octadienoic acid, 3,7-dimethyl-, isopentyl ester, (E)- ; 3-Methylbutyl (E)-3,7-dimethylocta-2,6-dienoate . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 143.4°C |
| Safety Data | |
 |
|
