| Identification | |
| Name: | Sebacic acid |
| Synonyms: | Sebacic acids;1, 10-Decanedioic acid;Sebacicacid;1,10-decanedioic acid;Sebacinsaeure;Decanedioic acid;Usaf hc-1;Decanedicarboxylic acid;1,8-Octanedicarboxylic acid; |
| CAS: | 111-20-6 |
| EINECS: | 203-845-5 |
| Molecular Formula: | C10H18O4 |
| Molecular Weight: | 202.25 |
| InChI: | InChI=1/C10H18O4/c11-9(12)7-5-3-1-2-4-6-8-10(13)14/h1-8H2,(H,11,12)(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.21 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, bases, reducing agents. |
| Refractive index: | 1.422 |
| Solubility: | 1 g/L in water |
| Appearance: | white powder |
| Specification: |
?Sebacic acid , with CAS number of 111-20-6, can be called decanedioic acid ; Sebacic acid ; 1, 10-Decanedioic acid ; 1,10-decanedioic acid ; Decanedioic acid ; 1,8-Octanedicarboxylic acid ; decanedioate . It is a?white powder,? Sebacic acid (CAS NO.111-20-6) is also used as an intermediate for antiseptics,aromatics and painting materials.?Sebacic acid (CAS NO.111-20-6) is a low toxic substance, with flammability, burning will produce toxic fumes, so it should be stored in cool and dry environment, dry powder, foam, sand, carbon dioxide, water mist can be used if something urgent happened. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29171310 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. No special precautions indicated. |
| Usage: | Raw material in the production of synthetic resins of the alkylated or polyester type, non-migrating plasticizers, polyester rubbers, synthetic fibers of the polyamide type. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
