| Identification | |
| Name: | sebacic acid, compound with 2-aminoethanol |
| Synonyms: | Sebacic acid, compound with 2-aminoethanol;Decanedioic acid, compd. with 2-aminoethanol;2-aminoethanol; decanedioic acid |
| CAS: | 82801-62-5 |
| EINECS: | 280-045-2 |
| Molecular Formula: | C12H25NO5 |
| Molecular Weight: | 263.3306 |
| InChI: | InChI=1/C10H18O4.C2H7NO/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;3-1-2-4/h1-8H2,(H,11,12)(H,13,14);4H,1-3H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 262.3°C |
| Boiling Point: | 510.1°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 262.3°C |
| Safety Data | |
 |
|
