| Identification |
| Name: | malic acid, compound with 2-aminoethanol |
| Synonyms: | Butanedioic acid, 2-hydroxy-, compd. with 2-aminoethanol (1:?);Butanedioic acid, hydroxy-, compd. with 2-aminoethanol;Malic acid, compd. with 2-aminoethanol;Malic acid, compound with 2-aminoethanol;2-hydroxybutanedioic acid - 2-aminoethanol (1:1) |
| CAS: | 29868-01-7 |
| EINECS: | 249-903-3 |
| Molecular Formula: | C6H13NO6 |
| Molecular Weight: | 195.1705 |
| InChI: | InChI=1/C4H6O5.C2H7NO/c5-2(4(8)9)1-3(6)7;3-1-2-4/h2,5H,1H2,(H,6,7)(H,8,9);4H,1-3H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 153.4°C |
| Boiling Point: | 306.4°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 153.4°C |
| Safety Data |
| |
 |
