Identification |
Name: | Sebacic acid, compound with 2,2-iminodiethanol |
Synonyms: | Sebacic acid, compound with 2,2'-iminodiethanol;decanedioic acid - 2,2'-iminodiethanol (1:1) |
CAS: | 84145-30-2 |
EINECS: | 282-256-5 |
Molecular Formula: | C14H29NO6 |
Molecular Weight: | 307.3832 |
InChI: | InChI=1/C10H18O4.C4H11NO2/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;6-3-1-5-2-4-7/h1-8H2,(H,11,12)(H,13,14);5-7H,1-4H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 567.5°Cat760mmHg |
Boiling Point: | 567.5°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 567.5°Cat760mmHg |
Safety Data |
|
 |