| Identification | |
| Name: | Phenol, 4-chloro-,potassium salt (1:1) |
| Synonyms: | Phenol,4-chloro-, potassium salt (9CI); Phenol, p-chloro-, potassium deriv. (6CI);Phenol, p-chloro-, potassium salt (8CI); Potassium, (p-chlorophenoxy)- (7CI);Potassium 4-chlorophenolate; Potassium 4-chlorophenoxide; Potassiump-chlorophenolate; Potassium p-chlorophenoxide; p-Chlorophenol potassium salt |
| CAS: | 1121-74-0 |
| Molecular Formula: | C6H5 Cl O . K |
| Molecular Weight: | 339.385 |
| InChI: | InChI=1/C6H5ClO.K/c7-5-1-3-6(8)4-2-5;/h1-4,8H;/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 42.8 deg C |
| Flash Point: | 172.2°C |
| Boiling Point: | 483.2°Cat760mmHg |
| Density: | 1.161g/cm3 |
| Solubility: | 2.71 PARTS SOL IN 100 PARTS WATER @ 20 DEG C Very sol in alc, glycerin, ether, chloroform, fixed and volatile oils; sparingly sol in liquid petroleum Very sol in ethanol, benzene, ethyl ether; soluble in alkali Soluble in aqueous alkali, oxygenated and aromatic solvents In water, 2.40X10+4 mg/L at 25 deg C [Roberts MS; J Pharm Pharmacol 29: 677-83 (1977)] PubMed Abstract |
| Flash Point: | 172.2°C |
| Color: | Needle like, white to straw-colored crystals White crystals (yellow or pink when impure) Yellow solid |
| Safety Data | |
 |
|
