| Identification | |
| Name: | Phenol, 2,4-dichloro-,potassium salt (1:1) |
| Synonyms: | Phenol,2,4-dichloro-, potassium salt (9CI); 2,4-Dichlorophenol potassium salt;Potassium 2,4-dichlorophenate; Potassium 2,4-dichlorophenolate; Potassium2,4-dichlorophenoxide |
| CAS: | 50884-30-5 |
| EINECS: | 256-829-5 |
| Molecular Formula: | C6H4 Cl2 O . K |
| Molecular Weight: | 201.09172 |
| InChI: | InChI=1/C6H4Cl2O.K/c7-4-1-2-6(9)5(8)3-4;/h1-3,9H;/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 45 deg C |
| Flash Point: | 113.9°C |
| Boiling Point: | 210°Cat760mmHg |
| Density: | 1.458g/cm3 |
| Solubility: | Soluble in carbon tetrachloride Soluble in ethanol, benzene, chloroform and ethyl ether. Soluble in aqueous alkali, oxygenated and chlorinated solvents. In water, 4.50X10+3 mg/L at 20 deg C |
| Flash Point: | 113.9°C |
| Color: | COLORLESS CRYSTALS OR NEEDLES Hexagonal needles from benzene White ... solid Pale yellow solid |
| Safety Data | |
 |
|
