| Identification | |
| Name: | Phenol, 2-methyl-,potassium salt (1:1) |
| Synonyms: | Phenol,2-methyl-, potassium salt (9CI); Potassium o-cresoxide (7CI); o-Cresol,potassium salt (8CI); Potassium 2-methylphenolate; Potassium 2-methylphenoxide;Potassium o-cresolate |
| CAS: | 3235-09-4 |
| EINECS: | 221-790-5 |
| Molecular Formula: | C7H8 O . K |
| Molecular Weight: | 146.22818 |
| InChI: | InChI=1/C7H8O.K/c1-6-4-2-3-5-7(6)8;/h2-5,8H,1H3;/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 30 deg C |
| Flash Point: | 218.5°C |
| Boiling Point: | 516.7°Cat760mmHg |
| Density: | 1.03g/cm3 |
| Solubility: | Sol in about 40 parts water. Miscible with ethanol, chloroform and ether. Sol in solution of the fixed alkali hydroxides. Sol in carbon tetrachloride SOL IN VEGETABLE OILS AT 30 DEG C In water, 2.59X10+4 mg/L at 25 deg C |
| Flash Point: | 218.5°C |
| Color: | Crystals in liquid becoming dark with age and exposure to light and air White crystals (Note: A liquid above 88 degrees F). |
| Safety Data | |
 |
|
