| Identification |
| Name: | Phenol,4-chloro-2-(phenylmethyl)-, potassium salt (1:1) |
| Synonyms: | Phenol,4-chloro-2-(phenylmethyl)-, potassium salt (9CI) |
| CAS: | 35471-49-9 |
| EINECS: | 252-585-9 |
| Molecular Formula: | C13H11 Cl O . K |
| Molecular Weight: | 218.67884 |
| InChI: | InChI=1S/C13H11ClO/c14-12-6-7-13(15)11(9-12)8-10-4-2-1-3-5-10/h1-7,9,15H,8H2 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 48.5 deg C |
| Flash Point: | 159.2°C |
| Boiling Point: | 339.6°C at 760 mmHg |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology No toxicological data available. Toxicity data (The meaning of any toxicological abbrevi |
| Solubility: | |
| Flash Point: | 159.2°C |
| Color: | White to light tan or pink flakes |
| Safety Data |
| |
 |
