| Identification | |
| Name: | 2-Octanol |
| Synonyms: | 1-Methyl-1-heptanol;1-Methylheptanol;1-Methylheptyl alcohol;2-Hydroxy-n-octane;2-Hydroxyoctane;2-Octyl alcohol;Capryl alcohol;DL-2-Octanol;Hexylmethylcarbinol;Methylhexylcarbinol;NSC 14759;dl-Methylhexylcarbinol;n-Octan-2-ol;s-Octylalcohol;sec-Caprylic alcohol;b-Octyl alcohol; |
| CAS: | 123-96-6 |
| EINECS: | 204-667-0 |
| Molecular Formula: | C8H18O |
| Molecular Weight: | 130.26 |
| InChI: | InChI=1S/C8H18O/c1-3-4-5-6-7-8(2)9/h8-9H,3-7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1987 |
| Melting Point: | -38 oC |
| Density: | 0.823 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. |
| Refractive index: | 1.425-1.427 |
| Water Solubility: | 0.1 G/100 ML (20 oC) |
| Solubility: | 0.1 g/100 mL (20 oC) |
| Appearance: | colourless liquid with a pungent odour |
| Specification: |
?2-Octanol (CAS NO.123-96-6) is also named as 1-Methyl-1-heptanol ; 1-Methylheptyl alcohol ; 2-Hydroxy-n-octane ; 2-Hydroxyoctane ; 2-Octanol (.+-) ; 2-Octanol (natural) ; 2-Octyl alcohol ; AI3-05598 ; Capryl alcohol ; Caprylic alcohol, secondary ; FEMA Number 2801 ; HSDB 5601 ; Hexyl methyl carbinol ; Hexylmethylcarbinol ; Methyl hexyl carbinol ; Methylhexylcarbinol ; NSC 14759 ; beta-Octyl alcohol ; n-Octan-2-ol ; s-Octyl alcohol ; sec-Caprylic alcohol ; secondary Caprylic alcohol .?2-Octanol (CAS NO.123-96-6) is colourless liquid with a pungent odour. It is?toxic and flammable. It will produce?stimulate smoke when buring. So the storage environment should be ventilate, low-temperature and dry. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | I; II; III |
| HS Code: | 29051620 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Color: | COLORLESS |
| Usage: | In manufacture of perfumes, in disinfectant soaps. To prevent foaming. Solvent for fats and waxes. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
