| Identification | |
| Name: | 2-Octanol |
| Synonyms: | (+/-)-2-Octanol |
| CAS: | 4128-31-8 |
| EINECS: | 223-938-4 |
| Molecular Formula: | C8H18O |
| Molecular Weight: | 130.23 |
| InChI: | InChI=1S/C8H18O/c1-3-4-5-6-7-8(2)9/h8-9H,3-7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1987 |
| Melting Point: | -38 °C |
| Flash Point: | 160 °F |
| Boiling Point: | 174-181 °C(lit.) |
| Density: | 0.819 g/mL at 25 °C(lit.) |
| Stability: | No data. |
| Refractive index: | n20/D 1.426(lit.) |
| Solubility: | Insoluble |
| Specification: | Safety Statements:37/39-26 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Packinggroup: | III |
| Flash Point: | 160 °F |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | COLORLESS |
| Safety Data | |
 |
|
