| Identification | |
| Name: | 2-Octanol,(2R)- |
| Synonyms: | 2-Octanol,(R)- (8CI); (-)-2-Octanol; (2R)-2-Octanol; (R)-(-)-2-Octanol; (R)-(-)-2-Octylalcohol; (R)-1-Methylheptanol; (R)-2-Octanol; L-(-)-Octan-2-ol; L-2-Octanol;l-2-Octanol |
| CAS: | 5978-70-1 |
| EINECS: | 227-777-0 |
| Molecular Formula: | C8H18 O |
| Molecular Weight: | 130.23 |
| InChI: | InChI=1S/C8H18O/c1-3-4-5-6-7-8(2)9/h8-9H,3-7H2,1-2H3/t8-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 71 oC |
| Boiling Point: | 175 C |
| Density: | 0.83 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.425-1.427 |
| Alpha: | -9.5 o (NEAT) |
| Water Solubility: | 1 G/L (20 oC) |
| Solubility: | 1 g/l |
| Appearance: | clear liquid |
| Specification: |
?2-Octanol,(2R)- , its CAS NO. is 5978-70-1, the synonyms are EINECS 227-777-0 ; 2-Octanol, (theta)- ; l-Octan-2-ol . |
| Packinggroup: | I; II; III |
| HS Code: | 29051620 |
| Flash Point: | 71 oC |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
