| Identification | |
| Name: | Cyclopentanone,2-hexyl- |
| Synonyms: | 2-Hexyl-1-cyclopentanone;2-Hexylcyclopentanone;2-n-Hexylcyclopentanone;Jasmatone; |
| CAS: | 13074-65-2 |
| EINECS: | 235-970-6 |
| Molecular Formula: | C11H20 O |
| Molecular Weight: | 168.2759 |
| InChI: | InChI=1S/C11H20O/c1-2-3-4-5-7-10-8-6-9-11(10)12/h10H,2-9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | 92 ºC at 4 mm Hg |
| Density: | 0.89 |
| Refractive index: | 1.4495 |
| Water Solubility: | at 25 deg C (mg/L): 63.27 Insoluble in water; soluble in alcohol. |
| Solubility: | at 25 deg C (mg/L): 63.27 Insoluble in water; soluble in alcohol. |
| Appearance: | light yellow liquid |
| Specification: |
2-Hexylcyclopentanone with CAS Registry Number of 13074-65-2 is also known as 2-n-Hexylcyclopentanone ; 4-07-00-00099 (Beilstein Handbook Reference) ; 2-Hexylcyclopentan-1-one ; Cyclopentanone, 2-hexyl- . |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
