| Identification | |
| Name: | Pheniramine maleate |
| Synonyms: | dimethyl-[3-phenyl-3-(1H-pyridin-6-yl)propyl]azanium; propanedioate;Prestwick_769;Naphcon A;2-Pyridinepropanamine,N,N-dimethyl-?- phenyl-,(2Z)-2-butenedioate (1:1);but-2-enedioic acid; N,N-dimethyl-3-phenyl-3-pyridin-2-yl-propan-1-amine;Pheniramine maleate (JAN/USP); |
| CAS: | 132-20-7 |
| EINECS: | 205-051-4 |
| Molecular Formula: | C16H20N2.C4H4O4 |
| Molecular Weight: | 356.46 |
| InChI: | InChI=1/C16H20N2.C3H4O4/c1-18(2)13-11-15(14-8-4-3-5-9-14)16-10-6-7-12-17-16;4-2(5)1-3(6)7/h3-10,12,15H,11,13H2,1-2H3;1H2,(H,4,5)(H,6,7) |
| Molecular Structure: | ![(C16H20N2.C4H4O4) dimethyl-[3-phenyl-3-(1H-pyridin-6-yl)propyl]azanium; propanedioate;Prestwick_769;Naphcon A;2-Pyridi...](https://img1.guidechem.com/chem/e/dict/179/132-20-7.jpg) |
| Properties | |
| Melting Point: | 104-108 ºC |
| Density: | g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | >=1 G/100 ML AT 24 ºC |
| Solubility: | >=1 g/100 mL at 24 ºC in water |
| Appearance: | white powder |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Usage: | Used medicinally as an antihistaminic (merck). |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
