| Identification |
| Name: | Glyceryl monoricinoleate |
| Synonyms: | Loxiol G 11;9-Octadecenoic acid,12-hydroxy-,(9Z,12R)-,monoester with 1,2,3-propanetriol;Aldo MR;Rilanit GMRO; |
| CAS: | 1323-38-2 |
| EINECS: | 215-353-8 |
| Molecular Formula: | C21H40O5 |
| Molecular Weight: | 372.54 |
| InChI: | InChI=1/C21H40O5/c1-2-3-4-11-14-19(23)15-12-9-7-5-6-8-10-13-16-21(25)26-18-20(24)17-22/h9,12,19-20,22-24H,2-8,10-11,13-18H2,1H3/b12-9-/t19-,20-/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.019 g/cm3 |
| Refractive index: | 1.49 |
| Water Solubility: | Insoluble in water,Soluble in solvents |
| Solubility: | Insoluble in water,Soluble in solvents |
| Appearance: | Viscous liquid |
| Usage: | Lonzest(R) GMR finds use in a variety of applications and markets. It is suggested for use as an emulsifier in cosmetic formulations, household products, coatings, printing inks and plastics. |
| Safety Data |
| |
 |
