Identification |
Name: | Glyceryl monocaprate |
Synonyms: | Decanoic acid,monoester with 1,2,3-propanetriol;Sunsoft 760;Poem M 300;Sunsoft 767; |
CAS: | 26402-22-2 |
EINECS: | 247-668-1 |
Molecular Formula: | C13H26O4 |
Molecular Weight: | 246.34314 |
InChI: | InChI=1S/C13H26O4/c1-2-3-4-5-6-7-8-9-13(16)17-11-12(15)10-14/h12,14-15H,2-11H2,1H3 |
Molecular Structure: |
 |
Properties |
Transport: | 200kgs
|
Density: | 1.017 g/cm3 |
Refractive index: | 1.466 |
Water Solubility: | soluble
in hot water
SOLVENT |
Solubility: | soluble
in hot water
SOLVENT
| |
Appearance: | clear
semi-solid |
Storage Temperature: | −20°C |
Safety Data |
Hazard Symbols |
|
|
 |