| Identification |
| Name: | Propylene glycol monostearate |
| Synonyms: | 1, 2-Propylene glycol monostearate;Nikkol PMS 1C;1,2-Propanediol monostearate;Usaf ke-13;Aldo PGHMS;Nonex 32;NOCA;Nikkol PMS;Prostearin;Propylene glycol esters of Fatty Acid;Cerasynt PN;Cerasynt PA;Pegosperse PS;Dragil-P;Rikemal PS 100;Atlas G 924;Emerest 2381;Crill 26;Octadecanoic acid, monoester with 1,2-propanediol; |
| CAS: | 1323-39-3 |
| EINECS: | 215-354-3 |
| Molecular Formula: | C21H42O3 |
| Molecular Weight: | 342.56 |
| InChI: | InChI=1S/C21H42O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(23)24-19-20(2)22/h20,22H,3-19H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 20kgs |
| Melting Point: | 40 - 45 C |
| Flash Point: | 447.7 oC at 760 mmHg |
| Boiling Point: | 447.7 oC at 760 mmHg |
| Density: | 0.909 g/cm3 |
| Appearance: | white powder |
| Flash Point: | 447.7 oC at 760 mmHg |
| Usage: | Aldo(R) PGHMS KFG is used for cakes (improves aeration and volume), whipped toppings (promotes aeration and more stable foam structure) and shortenings. |
| Safety Data |
| |
 |
