| Identification | |
| Name: | Propylene glycol dicaprylate/dicaprate |
| Synonyms: | Decanoic acid, mixed diesters with octanoic acid and propylene glycol;Decansure, gemischte Diester mit Octansure und Propylenglykol;Caprylic, capric acid, propylene glycol diester; |
| CAS: | 68583-51-7 |
| EINECS: | 271-516-3 |
| Molecular Formula: | C21H44O6 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C10H20O2.C8H16O2.C3H8O2/c1-2-3-4-5-6-7-8-9-10(11)12;1-2-3-4-5-6-7-8(9)10;1-3(5)2-4/h2-9H2,1H3,(H,11,12);2-7H2,1H3,(H,9,10);3-5H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 121.8°C |
| Boiling Point: | 269.6°C at 760 mmHg |
| Flash Point: | 121.8°C |
| Safety Data | |
 |
|
