| Identification |
| Name: | Pyrazine,2-ethyl-5-methyl- |
| Synonyms: | 2-Methyl-5-ethylpyrazine;5-Methyl-2-ethylpyrazine; |
| CAS: | 13360-64-0 |
| EINECS: | 236-416-6 |
| Molecular Formula: | C7H10N2 |
| Molecular Weight: | 122.17 |
| InChI: | InChI=1/C7H10N2/c1-3-7-5-8-6(2)4-9-7/h4-5H,3H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 63°C |
| Boiling Point: | 170.8°Cat760mmHg |
| Density: | 0.977g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.4925 (25 C) |
| Solubility: | Slightly soluble |
| Packinggroup: | III |
| Flash Point: | 63°C |
| Storage Temperature: | Keep tightly closed. Keep away from heat and open flame. |
| Usage: | Flavoring additive. |
| Safety Data |
| |
 |
