Identification |
Name: | Pyrazine,2-ethyl-3-methyl- |
Synonyms: | 2-Ethyl-3-methyl-1,4-pyrazine;3-Ethyl-2-methylpyrazine;3-Methyl-2-ethylpyrazine; |
CAS: | 15707-23-0 |
EINECS: | 239-799-8 |
Molecular Formula: | C7H10N2 |
Molecular Weight: | 122.17 |
InChI: | InChI=1/C7H10N2/c1-3-7-6(2)8-4-5-9-7/h4-5H,3H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Transport: | UN 1993 |
Density: | 0.987 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.502-1.504 |
Water Solubility: | sparingly soluble |
Solubility: | sparingly soluble |
Appearance: | colorless liquid |
Packinggroup: | III |
Storage Temperature: | Keep away from heat, sparks, and flame. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. Keep containers tightly closed. |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
 |