| Identification | |
| Name: | Benzaldehyde,2-methoxy- |
| Synonyms: | Benzaldehyde,o-methoxy- (3CI);o-Anisaldehyde (8CI);2-(Methyloxy)benzaldehyde;2-Anisaldehyde;2-Methoxybenzaldehyde;2-Methoxybenzenecarboxaldehyde;2-Methoxyphenylformaldehyde;6-Methoxybenzaldehyde;NC 064;NSC 58960;Salicylaldehyde methyl ether;o-Formylanisole;o-Methoxybenzaldehyde; |
| CAS: | 135-02-4 |
| EINECS: | 205-171-7 |
| Molecular Formula: | C8H8O2 |
| Molecular Weight: | 136.15 |
| InChI: | InChI=1/C8H8O2/c1-10-8-5-3-2-4-7(8)6-9/h2-6H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.127 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5608 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | light yellow to pale brown chemical |
| Packinggroup: | I; II; III |
| HS Code: | 29124900 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Usage: | Food flavor additive. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
