| Identification | |
| Name: | Benzaldehyde,4-fluoro-2-methoxy- |
| Synonyms: | 4-Fluoro-2-methoxybenzaldehyde; |
| CAS: | 450-83-9 |
| Molecular Formula: | C8H7FO2 |
| Molecular Weight: | 154.14 |
| InChI: | InChI=1/C8H7FO2/c1-11-8-4-7(9)3-2-6(8)5-10/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 55 °C |
| Flash Point: | 87.2°C |
| Boiling Point: | 224.6°Cat760mmHg |
| Density: | 1.192g/cm3 |
| Refractive index: | 1.525 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 87.2°C |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
