| Identification | |
| Name: | 1,2,4-Trimethoxybenzene |
| Synonyms: | Benzene,1,2,4-trimethoxy-;TMB 124;EPA Pesticide Chemical Code 040515;1,2,4-Trimethoxy Benzene; |
| CAS: | 135-77-3 |
| EINECS: | 205-219-7 |
| Molecular Formula: | C9H12O3 |
| Molecular Weight: | 168.19 |
| InChI: | InChI=1/C9H12O3/c1-10-7-4-5-8(11-2)9(6-7)12-3/h4-6H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 19 - 21 |
| Density: | 1.128 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.532-1.534 |
| Solubility: | Insoluble |
| Appearance: | clear light yellow to yellow-brown liquid |
| Specification: |
?1,2,4-Trimethoxybenzene (CAS NO.135-77-3) is also named as?AI3-20797 ; EPA Pesticide Chemical Code 040515 ; Benzene, 1,2,4-trimethoxy- ;?1,2,4-Trimethoxy Benzene .?1,2,4-Trimethoxybenzene (CAS NO.135-77-3) is clear light yellow to yellow-brown liquid. |
| HS Code: | 29093090 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Insecticide, insect repellent, dog and cat repellent. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
