| Identification |
| Name: | 1,3,5-Trimethoxybenzene |
| Synonyms: | 1,3,5-Trimethoxybenzene/Phloroglucinol trimethyl ether; O,O,O-1,3,5-trimethylresorcinol; Phloroglucinol trimethyl ether; 1,3,5-trimethyoxy benzene |
| CAS: | 621-23-8 |
| EINECS: | 210-673-4 |
| Molecular Formula: | C9H12O3 |
| Molecular Weight: | 168.19 |
| InChI: | InChI=1/C9H12O3/c1-10-7-4-8(11-2)6-9(5-7)12-3/h4-6H,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Density: | 1.041 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1,533 |
| Water Solubility: | insoluble |
| Solubility: | Insoluble |
| Appearance: | white to off-white crystal |
| Packinggroup: | III |
| HS Code: | 29093090 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
