| Identification | |
| Name: | 1,2,3-Trimethoxybenzene |
| Synonyms: | 3,4,5-Trimethoxybenzole;NSC 10124;Pyrogallol trimethyl ether;Tri-O-methylpyrogallol;1,2,3-Trimethoxy benzene; |
| CAS: | 634-36-6 |
| EINECS: | 211-207-2 |
| Molecular Formula: | C9H12O3 |
| Molecular Weight: | 168.18978 |
| InChI: | InChI=1S/C9H12O3/c1-10-7-5-4-6-8(11-2)9(7)12-3/h4-6H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | 1.11 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.485 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | white to off-white crystalline powder |
| Specification: | WHITE TO DARK BEIGE POWDER Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| HS Code: | 29093090 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
 |
|
