| Identification | |
| Name: | DL-2-Methyl-1-butanol |
| Synonyms: | 2-Methyl-1-Butanol (DL-); (+/-)-2-Methyl-1-butanol; sec-Butylcarbinol; Primary active amyl alcohol; Natural Active 2-methylbutanol; L-2-methylbutanol |
| CAS: | 137-32-6 |
| EINECS: | 205-289-9 |
| Molecular Formula: | C5H12O |
| Molecular Weight: | 88.15 |
| InChI: | InChI=1/C5H12O/c1-3-5(2)4-6/h5-6H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1105 |
| Density: | 0.815 |
| Stability: | No data. |
| Refractive index: | 1.409-1.411 |
| Solubility: | 3.6 g/100 mL (30 oC) |
| Appearance: | colorless to light yellow clear oily liquid. |
| Report: |
?2-Methyl-1-Butanol (CAS NO.137-32-6)'s reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29051500 |
| Storage Temperature: | Flammables area |
| Color: | COLORLESS LIQ |
| Usage: | Solvent, organic synthesis (introduction of active amyl group), in lubricants, plasticizers, additives for oils & paints. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
