Specification: |
The L-tert-Leucine hydrochloride, with CAS registry number 139163-43-2, belongs to the following product categories: (1)Amino Acids & Deriv.; (2)Chiral chemicals. It has the systematic name of L-valine, 3-methyl-, hydrochloride (1:1). Besides this, it is also called 3-Methyl-L-valine hydrochloride (1:1). And the chemical formula of this chemical is C6H14ClNO2.
You can still convert the following datas into molecular structure:
(1)SMILES: CC(C)(C)[C@@H](C(=O)O)N.Cl
(2)InChI: InChI=1/C6H13NO2.ClH/c1-6(2,3)4(7)5(8)9;/h4H,7H2,1-3H3,(H,8,9);1H/t4-;/m1./s1
(3)InChIKey: OLMBOHVAVKHHTK-PGMHMLKABZ
(4)Std. InChI: InChI=1S/C6H13NO2.ClH/c1-6(2,3)4(7)5(8)9;/h4H,7H2,1-3H3,(H,8,9);1H/t4-;/m1./s1
(5)Std. InChIKey: OLMBOHVAVKHHTK-PGMHMLKASA-N
|