| Identification | |
| Name: | L-Valine,ethyl ester, hydrochloride (1:1) |
| CAS: | 17609-47-1 |
| EINECS: | 241-580-7 |
| Molecular Formula: | C7H15NO2.HCl |
| Molecular Weight: | 181.66 |
| InChI: | InChI=1/C7H15NO2.ClH/c1-4-10-7(9)6(8)5(2)3;/h5-6H,4,8H2,1-3H3;1H/t6-;/m0./s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | 7 º (C=2, H2O) |
| Solubility: |
Appearance:White to off-white crystalline powder Transport Information: OTH Hazard Symbols:Not regulated UN NO. particular:particular |
| Appearance: | White to off-white crystalline powder |
| Specification: |
Ethyl L-valinate hydrochloride ,its CAS NO. is 17609-47-1,the synonyms is H-val-oet hcl ; H-val-oet hydrochloride ; (l)-Ethyl 2-amino-3-methylbutanoate hydrochloride ; Ethyl 2-amino-3-methylbutanoate hydrochloride ; l-Valine ethyl ester hcl ; l-Valine ethyl ester hydrochloride ; Valine-oet hcl ; Ethyl l-valinate hydrochloride . |
| Storage Temperature: | Store at RT. |
| Safety Data | |
| Hazard Symbols | |
 |
|
