| Identification | |
| Name: | L-Valine methyl ester hydrochloride |
| CAS: | 6306-52-1 |
| EINECS: | 228-620-9 |
| Molecular Formula: | C6H14ClNO2 |
| Molecular Weight: | 167.63 |
| InChI: | InChI=1/C6H13NO2.ClH/c1-4(2)5(7)6(8)9-3;/h4-5H,7H2,1-3H3;1H/t5-;/m0./s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Flash Point: | 20.7oC |
| Boiling Point: | 145.7 oC at 760 mmHg |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Alpha: | 15.5 o (C=2,H2O 24 oC) |
| Appearance: | White to off-white crystalline powder |
| Specification: |
Materials to Avoid: Strong oxidizing agents. |
| HS Code: | 29224995 |
| Flash Point: | 20.7oC |
| Storage Temperature: | Store at RT. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
