| Identification | |
| Name: | Tetradecanoic acid,1-methylethyl ester |
| Synonyms: | Myristicacid, isopropyl ester (6CI,7CI,8CI); 1-Methylethyl tetradecanoate; Bisomel;Crodacol IPM; Crodamol IPM; D 50; D 50 (emollient); Deltyl Extra; Emcol IM;Emerest 2314; Estol 1512; Estol 1514; Estol IPM 1512; Exceparl IPM; IPM; IPM100; IPM-EX; IPM-R; Isomyst; Isopropyl myristate; Isopropyl tetradecanoate;Kessco IPM; Kesscomir; Lexol IPM; NSC 406280; Nikkol IPM; Nikkol IPM 100;Nikkol IPM-EX; Pelemol IPM; Promyr; Radia 7190; Rilanit IPM; Sinnoester MIP;Stepan D 50; Stepan IPM; Tegosoft M; Wickenol 101 |
| CAS: | 1405-98-7 |
| Molecular Formula: | C17H34 O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C17H34O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-17(18)19-16(2)3/h16H,4-15H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | Approximately 3 deg C |
| Flash Point: | 144.1°C |
| Boiling Point: | 319.9°Cat760mmHg |
| Density: | 0.864g/cm3 |
| Solubility: | Sol in castor oil, cottonseed oil, acetone, chloroform, ethyl acetate, ethanol, toluene, and mineral oil; practically insol in water, glycerol, propylene glycol Insoluble in water, sol in ethanol and ether, very sol in acetone |
| Flash Point: | 144.1°C |
| Color: | Liquid of low viscosity Colorless oil |
| Safety Data | |
 |
|
