| Identification | |
| Name: | acrylic acid; butyl 2-methylprop-2-enoate; N-isopropylprop-2-enamide |
| Synonyms: | AC1L4BEX;Butyl 2-methylprop-2-enoate; N-propan-2-ylprop-2-enamide; Prop-2-enoic Acid;147369-81-1;2-Propenoic acid, 2-methyl-, butyl ester, polymer with N-(1-methylethyl)-2-propenamide and 2-propenoic acid |
| CAS: | 147369-81-1 |
| Molecular Formula: | C17H29NO5 |
| Molecular Weight: | 327.4159 |
| InChI: | InChI=1/C8H14O2.C6H11NO.C3H4O2/c1-4-5-6-10-8(9)7(2)3;1-4-6(8)7-5(2)3;1-2-3(4)5/h2,4-6H2,1,3H3;4-5H,1H2,2-3H3,(H,7,8);2H,1H2,(H,4,5) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 50.6°C |
| Boiling Point: | 160°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 50.6°C |
| Safety Data | |
 |
|
