| Identification | |
| Name: | Ethanol, 2-mercapto-,1,1',1''-triester with boric acid (H3BO3) |
| Synonyms: | 1-Ethanol,2-mercapto-, borate (6CI); Ethanol, 2-mercapto-, 1-borate (7CI); Ethanol,2-mercapto-, O,O,O-triester with boric acid (H3BO3) (9CI); Ethanol,2-mercapto-, triester with boric acid (H3BO3) (8CI) |
| CAS: | 15582-80-6 |
| EINECS: | 239-642-3 |
| Molecular Formula: | C6H15 B O3 S3 |
| Molecular Weight: | 242.1875 |
| InChI: | InChI=1/C6H15BO3S3/c11-4-1-8-7(9-2-5-12)10-3-6-13/h11-13H,1-6H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 126.5°C |
| Boiling Point: | 285.6°Cat760mmHg |
| Density: | 1.149g/cm3 |
| Refractive index: | 1.502 |
| Flash Point: | 126.5°C |
| Safety Data | |
 |
|
